C16H18BrN3O2 — CID 48589989
4-bromo-5-cyclopropyl-N-[(4-methoxyphenyl)methyl]-N-methyl-1H-pyrazole-3-carboxamide (PubChem CID 48589989) has the molecular formula C16H18BrN3O2 and a molecular weight of 364.24 g/mol. Its IUPAC name is 4-bromo-5-cyclopropyl-N-[(4-methoxyphenyl)methyl]-N-methyl-1H-pyrazole-3-carboxamide.
| Compound Name | 4-bromo-5-cyclopropyl-N-[(4-methoxyphenyl)methyl]-N-methyl-1H-pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 48589989 |
| Molecular Formula | C16H18BrN3O2 |
| Molecular Weight | 364.24 g/mol |
| Exact Mass | 363.06 |
| IUPAC Name | 4-bromo-5-cyclopropyl-N-[(4-methoxyphenyl)methyl]-N-methyl-1H-pyrazole-3-carboxamide |
| SMILES | COc1ccc(CN(C)C(=O)c2n[nH]c(C3CC3)c2Br)cc1 |
| InChI | InChI=1S/C16H18BrN3O2/c1-20(9-10-3-7-12(22-2)8-4-10)16(21)15-13(17)14(18-19-15)11-5-6-11/h3-4,7-8,11H,5-6,9H2,1-2H3,(H,18,19) |
| InChIKey | NPENTONKAVIFKI-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 58.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.24 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |