C21H24N4O3S — CID 4860561
4-amino-5-(2,5-dimethoxyphenyl)-8,8-dimethyl-2-sulfanylidene-5,7,9,10-tetrahydro-3H-pyrimido[4,5-b]quinolin-6-one (PubChem CID 4860561) has the molecular formula C21H24N4O3S and a molecular weight of 412.52 g/mol. Its IUPAC name is 4-amino-5-(2,5-dimethoxyphenyl)-8,8-dimethyl-2-sulfanylidene-5,7,9,10-tetrahydro-3H-pyrimido[4,5-b]quinolin-6-one.
| Compound Name | 4-amino-5-(2,5-dimethoxyphenyl)-8,8-dimethyl-2-sulfanylidene-5,7,9,10-tetrahydro-3H-pyrimido[4,5-b]quinolin-6-one |
|---|---|
| PubChem CID | 4860561 |
| Molecular Formula | C21H24N4O3S |
| Molecular Weight | 412.52 g/mol |
| Exact Mass | 412.16 |
| IUPAC Name | 4-amino-5-(2,5-dimethoxyphenyl)-8,8-dimethyl-2-sulfanylidene-5,7,9,10-tetrahydro-3H-pyrimido[4,5-b]quinolin-6-one |
| SMILES | COc1ccc(OC)c(C2C3=C(CC(C)(C)CC3=O)Nc3nc(=S)[nH]c(N)c32)c1 |
| InChI | InChI=1S/C21H24N4O3S/c1-21(2)8-12-16(13(26)9-21)15(11-7-10(27-3)5-6-14(11)28-4)17-18(22)24-20(29)25-19(17)23-12/h5-7,15H,8-9H2,1-4H3,(H4,22,23,24,25,29) |
| InChIKey | BTEBHSNEKIKTGR-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 102.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.52 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|