C19H20N4O2S — CID 4860556
4-amino-5-(4-hydroxyphenyl)-8,8-dimethyl-2-sulfanylidene-5,7,9,10-tetrahydro-3H-pyrimido[4,5-b]quinolin-6-one (PubChem CID 4860556) has the molecular formula C19H20N4O2S and a molecular weight of 368.46 g/mol. Its IUPAC name is 4-amino-5-(4-hydroxyphenyl)-8,8-dimethyl-2-sulfanylidene-5,7,9,10-tetrahydro-3H-pyrimido[4,5-b]quinolin-6-one.
| Compound Name | 4-amino-5-(4-hydroxyphenyl)-8,8-dimethyl-2-sulfanylidene-5,7,9,10-tetrahydro-3H-pyrimido[4,5-b]quinolin-6-one |
|---|---|
| PubChem CID | 4860556 |
| Molecular Formula | C19H20N4O2S |
| Molecular Weight | 368.46 g/mol |
| Exact Mass | 368.13 |
| IUPAC Name | 4-amino-5-(4-hydroxyphenyl)-8,8-dimethyl-2-sulfanylidene-5,7,9,10-tetrahydro-3H-pyrimido[4,5-b]quinolin-6-one |
| SMILES | CC1(C)CC(=O)C2=C(C1)Nc1nc(=S)[nH]c(N)c1C2c1ccc(O)cc1 |
| InChI | InChI=1S/C19H20N4O2S/c1-19(2)7-11-14(12(25)8-19)13(9-3-5-10(24)6-4-9)15-16(20)22-18(26)23-17(15)21-11/h3-6,13,24H,7-8H2,1-2H3,(H4,20,21,22,23,26) |
| InChIKey | JEHNKNSUMZSWKD-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 104.03 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.46 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|