C21H27Br3N2O — CID 4861363
(4-benzylpiperazin-1-yl)-[6-bromo-4-(dibromomethyl)-5,5-dimethyl-1-bicyclo[2.1.1]hexanyl]methanone (PubChem CID 4861363) has the molecular formula C21H27Br3N2O and a molecular weight of 563.17 g/mol. Its IUPAC name is (4-benzylpiperazin-1-yl)-[6-bromo-4-(dibromomethyl)-5,5-dimethyl-1-bicyclo[2.1.1]hexanyl]methanone.
| Compound Name | (4-benzylpiperazin-1-yl)-[6-bromo-4-(dibromomethyl)-5,5-dimethyl-1-bicyclo[2.1.1]hexanyl]methanone |
|---|---|
| PubChem CID | 4861363 |
| Molecular Formula | C21H27Br3N2O |
| Molecular Weight | 563.17 g/mol |
| Exact Mass | 559.97 |
| IUPAC Name | (4-benzylpiperazin-1-yl)-[6-bromo-4-(dibromomethyl)-5,5-dimethyl-1-bicyclo[2.1.1]hexanyl]methanone |
| SMILES | CC1(C)C2(C(=O)N3CCN(Cc4ccccc4)CC3)CCC1(C(Br)Br)C2Br |
| InChI | InChI=1S/C21H27Br3N2O/c1-19(2)20(17(23)24)8-9-21(19,16(20)22)18(27)26-12-10-25(11-13-26)14-15-6-4-3-5-7-15/h3-7,16-17H,8-14H2,1-2H3 |
| InChIKey | TZEWKXGMMOKHOM-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.17 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|