C23H23Cl2N3O2 — CID 4862407
N-(2,5-dichlorophenyl)-4,7,7-trimethyl-2-oxo-3-(phenylhydrazinylidene)bicyclo[2.2.1]heptane-1-carboxamide (PubChem CID 4862407) has the molecular formula C23H23Cl2N3O2 and a molecular weight of 444.36 g/mol. Its IUPAC name is N-(2,5-dichlorophenyl)-4,7,7-trimethyl-2-oxo-3-(phenylhydrazinylidene)bicyclo[2.2.1]heptane-1-carboxamide.
| Compound Name | N-(2,5-dichlorophenyl)-4,7,7-trimethyl-2-oxo-3-(phenylhydrazinylidene)bicyclo[2.2.1]heptane-1-carboxamide |
|---|---|
| PubChem CID | 4862407 |
| Molecular Formula | C23H23Cl2N3O2 |
| Molecular Weight | 444.36 g/mol |
| Exact Mass | 443.12 |
| IUPAC Name | N-(2,5-dichlorophenyl)-4,7,7-trimethyl-2-oxo-3-(phenylhydrazinylidene)bicyclo[2.2.1]heptane-1-carboxamide |
| SMILES | CC12CCC(C(=O)Nc3cc(Cl)ccc3Cl)(C(=O)C1=NNc1ccccc1)C2(C)C |
| InChI | InChI=1S/C23H23Cl2N3O2/c1-21(2)22(3)11-12-23(21,20(30)26-17-13-14(24)9-10-16(17)25)19(29)18(22)28-27-15-7-5-4-6-8-15/h4-10,13,27H,11-12H2,1-3H3,(H,26,30) |
| InChIKey | YPYZLBFPGKZVNT-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.36 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|