C23H23N5O6 — CID 4730861
4,7,7-trimethyl-N-(4-nitrophenyl)-3-[(4-nitrophenyl)hydrazinylidene]-2-oxobicyclo[2.2.1]heptane-1-carboxamide (PubChem CID 4730861) has the molecular formula C23H23N5O6 and a molecular weight of 465.47 g/mol. Its IUPAC name is 4,7,7-trimethyl-N-(4-nitrophenyl)-3-[(4-nitrophenyl)hydrazinylidene]-2-oxobicyclo[2.2.1]heptane-1-carboxamide.
| Compound Name | 4,7,7-trimethyl-N-(4-nitrophenyl)-3-[(4-nitrophenyl)hydrazinylidene]-2-oxobicyclo[2.2.1]heptane-1-carboxamide |
|---|---|
| PubChem CID | 4730861 |
| Molecular Formula | C23H23N5O6 |
| Molecular Weight | 465.47 g/mol |
| Exact Mass | 465.16 |
| IUPAC Name | 4,7,7-trimethyl-N-(4-nitrophenyl)-3-[(4-nitrophenyl)hydrazinylidene]-2-oxobicyclo[2.2.1]heptane-1-carboxamide |
| SMILES | CC12CCC(C(=O)Nc3ccc([N+](=O)[O-])cc3)(C(=O)C1=NNc1ccc([N+](=O)[O-])cc1)C2(C)C |
| InChI | InChI=1S/C23H23N5O6/c1-21(2)22(3)12-13-23(21,20(30)24-14-4-8-16(9-5-14)27(31)32)19(29)18(22)26-25-15-6-10-17(11-7-15)28(33)34/h4-11,25H,12-13H2,1-3H3,(H,24,30) |
| InChIKey | YCMKPSQZZRFDPY-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 156.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.47 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|