C15H15BrFN3O — CID 48629926
1-[2-(5-bromo-2-fluorophenyl)ethyl]-3-(pyridin-2-ylmethyl)urea (PubChem CID 48629926) has the molecular formula C15H15BrFN3O and a molecular weight of 352.21 g/mol. Its IUPAC name is 1-[2-(5-bromo-2-fluorophenyl)ethyl]-3-(pyridin-2-ylmethyl)urea.
| Compound Name | 1-[2-(5-bromo-2-fluorophenyl)ethyl]-3-(pyridin-2-ylmethyl)urea |
|---|---|
| PubChem CID | 48629926 |
| Molecular Formula | C15H15BrFN3O |
| Molecular Weight | 352.21 g/mol |
| Exact Mass | 351.04 |
| IUPAC Name | 1-[2-(5-bromo-2-fluorophenyl)ethyl]-3-(pyridin-2-ylmethyl)urea |
| SMILES | O=C(NCCc1cc(Br)ccc1F)NCc1ccccn1 |
| InChI | InChI=1S/C15H15BrFN3O/c16-12-4-5-14(17)11(9-12)6-8-19-15(21)20-10-13-3-1-2-7-18-13/h1-5,7,9H,6,8,10H2,(H2,19,20,21) |
| InChIKey | OZUNKRKTYQGUIK-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.21 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |