C16H20N2O3 — CID 48631711
1-[[5-(4-methoxyphenyl)-1,3-oxazol-2-yl]methyl]piperidin-3-ol (PubChem CID 48631711) has the molecular formula C16H20N2O3 and a molecular weight of 288.35 g/mol. Its IUPAC name is 1-[[5-(4-methoxyphenyl)-1,3-oxazol-2-yl]methyl]piperidin-3-ol.
| Compound Name | 1-[[5-(4-methoxyphenyl)-1,3-oxazol-2-yl]methyl]piperidin-3-ol |
|---|---|
| PubChem CID | 48631711 |
| Molecular Formula | C16H20N2O3 |
| Molecular Weight | 288.35 g/mol |
| Exact Mass | 288.15 |
| IUPAC Name | 1-[[5-(4-methoxyphenyl)-1,3-oxazol-2-yl]methyl]piperidin-3-ol |
| SMILES | COc1ccc(-c2cnc(CN3CCCC(O)C3)o2)cc1 |
| InChI | InChI=1S/C16H20N2O3/c1-20-14-6-4-12(5-7-14)15-9-17-16(21-15)11-18-8-2-3-13(19)10-18/h4-7,9,13,19H,2-3,8,10-11H2,1H3 |
| InChIKey | XDKZJBZKQGFPBO-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 58.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.35 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |