C22H24N2O2 — CID 86972382
2-[[3-(phenoxymethyl)piperidin-1-yl]methyl]-5-phenyl-1,3-oxazole (PubChem CID 86972382) has the molecular formula C22H24N2O2 and a molecular weight of 348.45 g/mol. Its IUPAC name is 2-[[3-(phenoxymethyl)piperidin-1-yl]methyl]-5-phenyl-1,3-oxazole.
| Compound Name | 2-[[3-(phenoxymethyl)piperidin-1-yl]methyl]-5-phenyl-1,3-oxazole |
|---|---|
| PubChem CID | 86972382 |
| Molecular Formula | C22H24N2O2 |
| Molecular Weight | 348.45 g/mol |
| Exact Mass | 348.18 |
| IUPAC Name | 2-[[3-(phenoxymethyl)piperidin-1-yl]methyl]-5-phenyl-1,3-oxazole |
| SMILES | c1ccc(OCC2CCCN(Cc3ncc(-c4ccccc4)o3)C2)cc1 |
| InChI | InChI=1S/C22H24N2O2/c1-3-9-19(10-4-1)21-14-23-22(26-21)16-24-13-7-8-18(15-24)17-25-20-11-5-2-6-12-20/h1-6,9-12,14,18H,7-8,13,15-17H2 |
| InChIKey | SBPNEASHOUWSBY-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 38.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.45 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |