C18H19N5O — CID 18167942
5-phenyl-2-[(4-pyrazin-2-ylpiperazin-1-yl)methyl]-1,3-oxazole (PubChem CID 18167942) has the molecular formula C18H19N5O and a molecular weight of 321.38 g/mol. Its IUPAC name is 5-phenyl-2-[(4-pyrazin-2-ylpiperazin-1-yl)methyl]-1,3-oxazole.
| Compound Name | 5-phenyl-2-[(4-pyrazin-2-ylpiperazin-1-yl)methyl]-1,3-oxazole |
|---|---|
| PubChem CID | 18167942 |
| Molecular Formula | C18H19N5O |
| Molecular Weight | 321.38 g/mol |
| Exact Mass | 321.16 |
| IUPAC Name | 5-phenyl-2-[(4-pyrazin-2-ylpiperazin-1-yl)methyl]-1,3-oxazole |
| SMILES | c1ccc(-c2cnc(CN3CCN(c4cnccn4)CC3)o2)cc1 |
| InChI | InChI=1S/C18H19N5O/c1-2-4-15(5-3-1)16-12-21-18(24-16)14-22-8-10-23(11-9-22)17-13-19-6-7-20-17/h1-7,12-13H,8-11,14H2 |
| InChIKey | RDLZVSFIXSXLOE-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 58.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.38 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |