C21H29N5O — CID 135111107
4-benzyl-2-[(4-pyrazin-2-ylpiperazin-1-yl)methyl]-1,4-oxazepane (PubChem CID 135111107) has the molecular formula C21H29N5O and a molecular weight of 367.50 g/mol. Its IUPAC name is 4-benzyl-2-[(4-pyrazin-2-ylpiperazin-1-yl)methyl]-1,4-oxazepane.
| Compound Name | 4-benzyl-2-[(4-pyrazin-2-ylpiperazin-1-yl)methyl]-1,4-oxazepane |
|---|---|
| PubChem CID | 135111107 |
| Molecular Formula | C21H29N5O |
| Molecular Weight | 367.50 g/mol |
| Exact Mass | 367.24 |
| IUPAC Name | 4-benzyl-2-[(4-pyrazin-2-ylpiperazin-1-yl)methyl]-1,4-oxazepane |
| SMILES | c1ccc(CN2CCCOC(CN3CCN(c4cnccn4)CC3)C2)cc1 |
| InChI | InChI=1S/C21H29N5O/c1-2-5-19(6-3-1)16-25-9-4-14-27-20(18-25)17-24-10-12-26(13-11-24)21-15-22-7-8-23-21/h1-3,5-8,15,20H,4,9-14,16-18H2 |
| InChIKey | BFPIRTMMAPVYTN-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 44.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.50 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |