C16H20N2O — CID 75790350
2-[(2-methylpiperidin-1-yl)methyl]-5-phenyl-1,3-oxazole (PubChem CID 75790350) has the molecular formula C16H20N2O and a molecular weight of 256.35 g/mol. Its IUPAC name is 2-[(2-methylpiperidin-1-yl)methyl]-5-phenyl-1,3-oxazole.
| Compound Name | 2-[(2-methylpiperidin-1-yl)methyl]-5-phenyl-1,3-oxazole |
|---|---|
| PubChem CID | 75790350 |
| Molecular Formula | C16H20N2O |
| Molecular Weight | 256.35 g/mol |
| Exact Mass | 256.16 |
| IUPAC Name | 2-[(2-methylpiperidin-1-yl)methyl]-5-phenyl-1,3-oxazole |
| SMILES | CC1CCCCN1Cc1ncc(-c2ccccc2)o1 |
| InChI | InChI=1S/C16H20N2O/c1-13-7-5-6-10-18(13)12-16-17-11-15(19-16)14-8-3-2-4-9-14/h2-4,8-9,11,13H,5-7,10,12H2,1H3 |
| InChIKey | JEDLIQNREHVSMC-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 29.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.35 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |