C21H21FN2O4 — CID 48670345
ethyl 3-[2-(3-cyanophenoxy)propanoylamino]-3-(4-fluorophenyl)propanoate (PubChem CID 48670345) has the molecular formula C21H21FN2O4 and a molecular weight of 384.41 g/mol. Its IUPAC name is ethyl 3-[2-(3-cyanophenoxy)propanoylamino]-3-(4-fluorophenyl)propanoate.
| Compound Name | ethyl 3-[2-(3-cyanophenoxy)propanoylamino]-3-(4-fluorophenyl)propanoate |
|---|---|
| PubChem CID | 48670345 |
| Molecular Formula | C21H21FN2O4 |
| Molecular Weight | 384.41 g/mol |
| Exact Mass | 384.15 |
| IUPAC Name | ethyl 3-[2-(3-cyanophenoxy)propanoylamino]-3-(4-fluorophenyl)propanoate |
| SMILES | CCOC(=O)CC(NC(=O)C(C)Oc1cccc(C#N)c1)c1ccc(F)cc1 |
| InChI | InChI=1S/C21H21FN2O4/c1-3-27-20(25)12-19(16-7-9-17(22)10-8-16)24-21(26)14(2)28-18-6-4-5-15(11-18)13-23/h4-11,14,19H,3,12H2,1-2H3,(H,24,26) |
| InChIKey | DKIMECPWJCKYBN-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 88.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.41 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |