C20H21FN2O3 — CID 48692333
N-[2-[(2-fluorobenzoyl)amino]ethyl]-3-hydroxy-5,6,7,8-tetrahydronaphthalene-2-carboxamide (PubChem CID 48692333) has the molecular formula C20H21FN2O3 and a molecular weight of 356.40 g/mol. Its IUPAC name is N-[2-[(2-fluorobenzoyl)amino]ethyl]-3-hydroxy-5,6,7,8-tetrahydronaphthalene-2-carboxamide.
| Compound Name | N-[2-[(2-fluorobenzoyl)amino]ethyl]-3-hydroxy-5,6,7,8-tetrahydronaphthalene-2-carboxamide |
|---|---|
| PubChem CID | 48692333 |
| Molecular Formula | C20H21FN2O3 |
| Molecular Weight | 356.40 g/mol |
| Exact Mass | 356.15 |
| IUPAC Name | N-[2-[(2-fluorobenzoyl)amino]ethyl]-3-hydroxy-5,6,7,8-tetrahydronaphthalene-2-carboxamide |
| SMILES | O=C(NCCNC(=O)c1ccccc1F)c1cc2c(cc1O)CCCC2 |
| InChI | InChI=1S/C20H21FN2O3/c21-17-8-4-3-7-15(17)19(25)22-9-10-23-20(26)16-11-13-5-1-2-6-14(13)12-18(16)24/h3-4,7-8,11-12,24H,1-2,5-6,9-10H2,(H,22,25)(H,23,26) |
| InChIKey | PGMFDADEYODNNA-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.40 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|