C17H18N4O4 — CID 48735845
N-[2-[(1,4-dioxo-2,3-dihydrophthalazin-5-yl)amino]-2-oxoethyl]cyclohex-3-ene-1-carboxamide (PubChem CID 48735845) has the molecular formula C17H18N4O4 and a molecular weight of 342.36 g/mol. Its IUPAC name is N-[2-[(1,4-dioxo-2,3-dihydrophthalazin-5-yl)amino]-2-oxoethyl]cyclohex-3-ene-1-carboxamide.
| Compound Name | N-[2-[(1,4-dioxo-2,3-dihydrophthalazin-5-yl)amino]-2-oxoethyl]cyclohex-3-ene-1-carboxamide |
|---|---|
| PubChem CID | 48735845 |
| Molecular Formula | C17H18N4O4 |
| Molecular Weight | 342.36 g/mol |
| Exact Mass | 342.13 |
| IUPAC Name | N-[2-[(1,4-dioxo-2,3-dihydrophthalazin-5-yl)amino]-2-oxoethyl]cyclohex-3-ene-1-carboxamide |
| SMILES | O=C(CNC(=O)C1CC=CCC1)Nc1cccc2c(=O)[nH][nH]c(=O)c12 |
| InChI | InChI=1S/C17H18N4O4/c22-13(9-18-15(23)10-5-2-1-3-6-10)19-12-8-4-7-11-14(12)17(25)21-20-16(11)24/h1-2,4,7-8,10H,3,5-6,9H2,(H,18,23)(H,19,22)(H,20,24)(H,21,25) |
| InChIKey | MLDXMNACOVLHAC-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 123.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.36 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|