C20H17ClF3NO2 — CID 4874095
5-(4-chlorobenzoyl)-5-methyl-1-[[4-(trifluoromethyl)phenyl]methyl]pyrrolidin-2-one (PubChem CID 4874095) has the molecular formula C20H17ClF3NO2 and a molecular weight of 395.81 g/mol. Its IUPAC name is 5-(4-chlorobenzoyl)-5-methyl-1-[[4-(trifluoromethyl)phenyl]methyl]pyrrolidin-2-one.
| Compound Name | 5-(4-chlorobenzoyl)-5-methyl-1-[[4-(trifluoromethyl)phenyl]methyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 4874095 |
| Molecular Formula | C20H17ClF3NO2 |
| Molecular Weight | 395.81 g/mol |
| Exact Mass | 395.09 |
| IUPAC Name | 5-(4-chlorobenzoyl)-5-methyl-1-[[4-(trifluoromethyl)phenyl]methyl]pyrrolidin-2-one |
| SMILES | CC1(C(=O)c2ccc(Cl)cc2)CCC(=O)N1Cc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C20H17ClF3NO2/c1-19(18(27)14-4-8-16(21)9-5-14)11-10-17(26)25(19)12-13-2-6-15(7-3-13)20(22,23)24/h2-9H,10-12H2,1H3 |
| InChIKey | ODFWYVONRXBQJI-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.81 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |