C19H21N4O4+ — CID 4874556
3-ethyl-N,1-bis(3-methoxyphenyl)-5-oxo-2H-triazol-3-ium-4-carboxamide (PubChem CID 4874556) has the molecular formula C19H21N4O4+ and a molecular weight of 369.40 g/mol. Its IUPAC name is 3-ethyl-N,1-bis(3-methoxyphenyl)-5-oxo-2H-triazol-3-ium-4-carboxamide.
| Compound Name | 3-ethyl-N,1-bis(3-methoxyphenyl)-5-oxo-2H-triazol-3-ium-4-carboxamide |
|---|---|
| PubChem CID | 4874556 |
| Molecular Formula | C19H21N4O4+ |
| Molecular Weight | 369.40 g/mol |
| Exact Mass | 369.16 |
| IUPAC Name | 3-ethyl-N,1-bis(3-methoxyphenyl)-5-oxo-2H-triazol-3-ium-4-carboxamide |
| SMILES | CC[n+]1[nH]n(-c2cccc(OC)c2)c(=O)c1C(=O)Nc1cccc(OC)c1 |
| InChI | InChI=1S/C19H20N4O4/c1-4-22-17(18(24)20-13-7-5-9-15(11-13)26-2)19(25)23(21-22)14-8-6-10-16(12-14)27-3/h5-12H,4H2,1-3H3,(H-,20,21,24,25)/p+1 |
| InChIKey | XGOLQTMEQWVYCC-UHFFFAOYSA-O |
| XLogP | 1.74 |
| TPSA | 89.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.40 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|