C23H20F3N3O4S — CID 4874894
N-methyl-4-[methyl(phenyl)sulfamoyl]-N-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]benzamide (PubChem CID 4874894) has the molecular formula C23H20F3N3O4S and a molecular weight of 491.49 g/mol. Its IUPAC name is N-methyl-4-[methyl(phenyl)sulfamoyl]-N-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]benzamide.
| Compound Name | N-methyl-4-[methyl(phenyl)sulfamoyl]-N-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]benzamide |
|---|---|
| PubChem CID | 4874894 |
| Molecular Formula | C23H20F3N3O4S |
| Molecular Weight | 491.49 g/mol |
| Exact Mass | 491.11 |
| IUPAC Name | N-methyl-4-[methyl(phenyl)sulfamoyl]-N-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]benzamide |
| SMILES | CN(CC(=O)Nc1ccc(F)c(F)c1F)C(=O)c1ccc(S(=O)(=O)N(C)c2ccccc2)cc1 |
| InChI | InChI=1S/C23H20F3N3O4S/c1-28(14-20(30)27-19-13-12-18(24)21(25)22(19)26)23(31)15-8-10-17(11-9-15)34(32,33)29(2)16-6-4-3-5-7-16/h3-13H,14H2,1-2H3,(H,27,30) |
| InChIKey | YFGXVUOIKRZMIA-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.49 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|