C20H16BrFN2O3S — CID 2711561
N-(4-bromo-2-fluorophenyl)-4-[methyl(phenyl)sulfamoyl]benzamide (PubChem CID 2711561) has the molecular formula C20H16BrFN2O3S and a molecular weight of 463.33 g/mol. Its IUPAC name is N-(4-bromo-2-fluorophenyl)-4-[methyl(phenyl)sulfamoyl]benzamide.
| Compound Name | N-(4-bromo-2-fluorophenyl)-4-[methyl(phenyl)sulfamoyl]benzamide |
|---|---|
| PubChem CID | 2711561 |
| Molecular Formula | C20H16BrFN2O3S |
| Molecular Weight | 463.33 g/mol |
| Exact Mass | 462.00 |
| IUPAC Name | N-(4-bromo-2-fluorophenyl)-4-[methyl(phenyl)sulfamoyl]benzamide |
| SMILES | CN(c1ccccc1)S(=O)(=O)c1ccc(C(=O)Nc2ccc(Br)cc2F)cc1 |
| InChI | InChI=1S/C20H16BrFN2O3S/c1-24(16-5-3-2-4-6-16)28(26,27)17-10-7-14(8-11-17)20(25)23-19-12-9-15(21)13-18(19)22/h2-13H,1H3,(H,23,25) |
| InChIKey | DMUBVQGRSYYXBU-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.33 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |