C23H30F2N2O2 — CID 4876054
1-[bis(4-fluorophenyl)methoxy]-3-[methyl-(1-methylpiperidin-4-yl)amino]propan-2-ol (PubChem CID 4876054) has the molecular formula C23H30F2N2O2 and a molecular weight of 404.50 g/mol. Its IUPAC name is 1-[bis(4-fluorophenyl)methoxy]-3-[methyl-(1-methylpiperidin-4-yl)amino]propan-2-ol.
| Compound Name | 1-[bis(4-fluorophenyl)methoxy]-3-[methyl-(1-methylpiperidin-4-yl)amino]propan-2-ol |
|---|---|
| PubChem CID | 4876054 |
| Molecular Formula | C23H30F2N2O2 |
| Molecular Weight | 404.50 g/mol |
| Exact Mass | 404.23 |
| IUPAC Name | 1-[bis(4-fluorophenyl)methoxy]-3-[methyl-(1-methylpiperidin-4-yl)amino]propan-2-ol |
| SMILES | CN1CCC(N(C)CC(O)COC(c2ccc(F)cc2)c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C23H30F2N2O2/c1-26-13-11-21(12-14-26)27(2)15-22(28)16-29-23(17-3-7-19(24)8-4-17)18-5-9-20(25)10-6-18/h3-10,21-23,28H,11-16H2,1-2H3 |
| InChIKey | QNHZXTRGJXXAGI-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 35.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.50 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |