C15H19N3O3 — CID 4876371
8-methyl-3-[2-oxo-2-(1H-pyrrol-2-yl)ethyl]-1,3-diazaspiro[4.5]decane-2,4-dione (PubChem CID 4876371) has the molecular formula C15H19N3O3 and a molecular weight of 289.33 g/mol. Its IUPAC name is 8-methyl-3-[2-oxo-2-(1H-pyrrol-2-yl)ethyl]-1,3-diazaspiro[4.5]decane-2,4-dione.
| Compound Name | 8-methyl-3-[2-oxo-2-(1H-pyrrol-2-yl)ethyl]-1,3-diazaspiro[4.5]decane-2,4-dione |
|---|---|
| PubChem CID | 4876371 |
| Molecular Formula | C15H19N3O3 |
| Molecular Weight | 289.33 g/mol |
| Exact Mass | 289.14 |
| IUPAC Name | 8-methyl-3-[2-oxo-2-(1H-pyrrol-2-yl)ethyl]-1,3-diazaspiro[4.5]decane-2,4-dione |
| SMILES | CC1CCC2(CC1)NC(=O)N(CC(=O)c1ccc[nH]1)C2=O |
| InChI | InChI=1S/C15H19N3O3/c1-10-4-6-15(7-5-10)13(20)18(14(21)17-15)9-12(19)11-3-2-8-16-11/h2-3,8,10,16H,4-7,9H2,1H3,(H,17,21) |
| InChIKey | IGIINJMDMURFFN-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 82.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.33 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|