C15H13BrO3 — CID 4876527
(1-bromonaphthalen-2-yl) oxolane-2-carboxylate (PubChem CID 4876527) has the molecular formula C15H13BrO3 and a molecular weight of 321.17 g/mol. Its IUPAC name is (1-bromonaphthalen-2-yl) oxolane-2-carboxylate.
| Compound Name | (1-bromonaphthalen-2-yl) oxolane-2-carboxylate |
|---|---|
| PubChem CID | 4876527 |
| Molecular Formula | C15H13BrO3 |
| Molecular Weight | 321.17 g/mol |
| Exact Mass | 320.00 |
| IUPAC Name | (1-bromonaphthalen-2-yl) oxolane-2-carboxylate |
| SMILES | O=C(Oc1ccc2ccccc2c1Br)C1CCCO1 |
| InChI | InChI=1S/C15H13BrO3/c16-14-11-5-2-1-4-10(11)7-8-12(14)19-15(17)13-6-3-9-18-13/h1-2,4-5,7-8,13H,3,6,9H2 |
| InChIKey | PVLVUMDRMOYFTO-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.17 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|