C25H27N3O4S2 — CID 4877934
N-(5-morpholin-4-ylsulfonyl-2-pyrrolidin-1-ylphenyl)-3-phenylthiophene-2-carboxamide (PubChem CID 4877934) has the molecular formula C25H27N3O4S2 and a molecular weight of 497.64 g/mol. Its IUPAC name is N-(5-morpholin-4-ylsulfonyl-2-pyrrolidin-1-ylphenyl)-3-phenylthiophene-2-carboxamide.
| Compound Name | N-(5-morpholin-4-ylsulfonyl-2-pyrrolidin-1-ylphenyl)-3-phenylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 4877934 |
| Molecular Formula | C25H27N3O4S2 |
| Molecular Weight | 497.64 g/mol |
| Exact Mass | 497.14 |
| IUPAC Name | N-(5-morpholin-4-ylsulfonyl-2-pyrrolidin-1-ylphenyl)-3-phenylthiophene-2-carboxamide |
| SMILES | O=C(Nc1cc(S(=O)(=O)N2CCOCC2)ccc1N1CCCC1)c1sccc1-c1ccccc1 |
| InChI | InChI=1S/C25H27N3O4S2/c29-25(24-21(10-17-33-24)19-6-2-1-3-7-19)26-22-18-20(8-9-23(22)27-11-4-5-12-27)34(30,31)28-13-15-32-16-14-28/h1-3,6-10,17-18H,4-5,11-16H2,(H,26,29) |
| InChIKey | JHUXMKAZQXMVSD-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.64 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |