C15H10N4O2S — CID 4880151
2-(phthalazin-1-yloxymethyl)-5-thiophen-2-yl-1,3,4-oxadiazole (PubChem CID 4880151) has the molecular formula C15H10N4O2S and a molecular weight of 310.34 g/mol. Its IUPAC name is 2-(phthalazin-1-yloxymethyl)-5-thiophen-2-yl-1,3,4-oxadiazole.
| Compound Name | 2-(phthalazin-1-yloxymethyl)-5-thiophen-2-yl-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 4880151 |
| Molecular Formula | C15H10N4O2S |
| Molecular Weight | 310.34 g/mol |
| Exact Mass | 310.05 |
| IUPAC Name | 2-(phthalazin-1-yloxymethyl)-5-thiophen-2-yl-1,3,4-oxadiazole |
| SMILES | c1csc(-c2nnc(COc3nncc4ccccc34)o2)c1 |
| InChI | InChI=1S/C15H10N4O2S/c1-2-5-11-10(4-1)8-16-18-14(11)20-9-13-17-19-15(21-13)12-6-3-7-22-12/h1-8H,9H2 |
| InChIKey | XBIQPAGPJOJZQH-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 73.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.34 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |