C19H14ClN3OS2 — CID 4880464
3-[5-[(2-chlorophenyl)methyl]-1,3-thiazol-2-yl]-2-imino-5-phenyl-1,3-thiazolidin-4-one (PubChem CID 4880464) has the molecular formula C19H14ClN3OS2 and a molecular weight of 399.93 g/mol. Its IUPAC name is 3-[5-[(2-chlorophenyl)methyl]-1,3-thiazol-2-yl]-2-imino-5-phenyl-1,3-thiazolidin-4-one.
| Compound Name | 3-[5-[(2-chlorophenyl)methyl]-1,3-thiazol-2-yl]-2-imino-5-phenyl-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 4880464 |
| Molecular Formula | C19H14ClN3OS2 |
| Molecular Weight | 399.93 g/mol |
| Exact Mass | 399.03 |
| IUPAC Name | 3-[5-[(2-chlorophenyl)methyl]-1,3-thiazol-2-yl]-2-imino-5-phenyl-1,3-thiazolidin-4-one |
| SMILES | [H]/N=C1\SC(c2ccccc2)C(=O)N1c1ncc(Cc2ccccc2Cl)s1 |
| InChI | InChI=1S/C19H14ClN3OS2/c20-15-9-5-4-8-13(15)10-14-11-22-19(25-14)23-17(24)16(26-18(23)21)12-6-2-1-3-7-12/h1-9,11,16,21H,10H2/b21-18- |
| InChIKey | LBLOJANXTVKNIY-UZYVYHOESA-N |
| XLogP | 5.14 |
| TPSA | 57.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.93 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|