C24H31N3O3S — CID 4881545
N-(1-adamantylmethyl)-2-[3-(2-methoxyethyl)-4-oxoquinazolin-2-yl]sulfanylacetamide (PubChem CID 4881545) has the molecular formula C24H31N3O3S and a molecular weight of 441.60 g/mol. Its IUPAC name is N-(1-adamantylmethyl)-2-[3-(2-methoxyethyl)-4-oxoquinazolin-2-yl]sulfanylacetamide.
| Compound Name | N-(1-adamantylmethyl)-2-[3-(2-methoxyethyl)-4-oxoquinazolin-2-yl]sulfanylacetamide |
|---|---|
| PubChem CID | 4881545 |
| Molecular Formula | C24H31N3O3S |
| Molecular Weight | 441.60 g/mol |
| Exact Mass | 441.21 |
| IUPAC Name | N-(1-adamantylmethyl)-2-[3-(2-methoxyethyl)-4-oxoquinazolin-2-yl]sulfanylacetamide |
| SMILES | COCCn1c(SCC(=O)NCC23CC4CC(CC(C4)C2)C3)nc2ccccc2c1=O |
| InChI | InChI=1S/C24H31N3O3S/c1-30-7-6-27-22(29)19-4-2-3-5-20(19)26-23(27)31-14-21(28)25-15-24-11-16-8-17(12-24)10-18(9-16)13-24/h2-5,16-18H,6-15H2,1H3,(H,25,28) |
| InChIKey | VEPWYHLAWYBYSX-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.60 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |