C20H17ClFN3O3S — CID 4882339
4-[[(3-chloro-4-fluorophenyl)sulfonylamino]methyl]-N-(pyridin-2-ylmethyl)benzamide (PubChem CID 4882339) has the molecular formula C20H17ClFN3O3S and a molecular weight of 433.89 g/mol. Its IUPAC name is 4-[[(3-chloro-4-fluorophenyl)sulfonylamino]methyl]-N-(pyridin-2-ylmethyl)benzamide.
| Compound Name | 4-[[(3-chloro-4-fluorophenyl)sulfonylamino]methyl]-N-(pyridin-2-ylmethyl)benzamide |
|---|---|
| PubChem CID | 4882339 |
| Molecular Formula | C20H17ClFN3O3S |
| Molecular Weight | 433.89 g/mol |
| Exact Mass | 433.07 |
| IUPAC Name | 4-[[(3-chloro-4-fluorophenyl)sulfonylamino]methyl]-N-(pyridin-2-ylmethyl)benzamide |
| SMILES | O=C(NCc1ccccn1)c1ccc(CNS(=O)(=O)c2ccc(F)c(Cl)c2)cc1 |
| InChI | InChI=1S/C20H17ClFN3O3S/c21-18-11-17(8-9-19(18)22)29(27,28)25-12-14-4-6-15(7-5-14)20(26)24-13-16-3-1-2-10-23-16/h1-11,25H,12-13H2,(H,24,26) |
| InChIKey | QXEAHFSJQPMFBP-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 88.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.89 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |