C18H24N4OS — CID 48840230
3-(3-methyl-1,2,4-oxadiazol-5-yl)-N-(4-propan-2-ylphenyl)piperidine-1-carbothioamide (PubChem CID 48840230) has the molecular formula C18H24N4OS and a molecular weight of 344.48 g/mol. Its IUPAC name is 3-(3-methyl-1,2,4-oxadiazol-5-yl)-N-(4-propan-2-ylphenyl)piperidine-1-carbothioamide.
| Compound Name | 3-(3-methyl-1,2,4-oxadiazol-5-yl)-N-(4-propan-2-ylphenyl)piperidine-1-carbothioamide |
|---|---|
| PubChem CID | 48840230 |
| Molecular Formula | C18H24N4OS |
| Molecular Weight | 344.48 g/mol |
| Exact Mass | 344.17 |
| IUPAC Name | 3-(3-methyl-1,2,4-oxadiazol-5-yl)-N-(4-propan-2-ylphenyl)piperidine-1-carbothioamide |
| SMILES | Cc1noc(C2CCCN(C(=S)Nc3ccc(C(C)C)cc3)C2)n1 |
| InChI | InChI=1S/C18H24N4OS/c1-12(2)14-6-8-16(9-7-14)20-18(24)22-10-4-5-15(11-22)17-19-13(3)21-23-17/h6-9,12,15H,4-5,10-11H2,1-3H3,(H,20,24) |
| InChIKey | QTGFXBSRNUIUFC-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 54.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.48 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|