About 1-ethyl-3-(5-phenyl-1H-1,2,4-triazol-3-yl)urea
1-ethyl-3-(5-phenyl-1H-1,2,4-triazol-3-yl)urea (PubChem CID 4885272) has the molecular formula C11H13N5O
and a molecular weight of 231.26 g/mol. Its IUPAC name is 1-ethyl-3-(5-phenyl-1H-1,2,4-triazol-3-yl)urea.
Molecular Properties
| Compound Name | 1-ethyl-3-(5-phenyl-1H-1,2,4-triazol-3-yl)urea |
| PubChem CID | 4885272 |
| Molecular Formula | C11H13N5O |
| Molecular Weight | 231.26 g/mol |
| Exact Mass | 231.11 |
| IUPAC Name | 1-ethyl-3-(5-phenyl-1H-1,2,4-triazol-3-yl)urea |
| SMILES | CCNC(=O)Nc1n[nH]c(-c2ccccc2)n1 |
| InChI | InChI=1S/C11H13N5O/c1-2-12-11(17)14-10-13-9(15-16-10)8-6-4-3-5-7-8/h3-7H,2H2,1H3,(H3,12,13,14,15,16,17) |
| InChIKey | KJHFESGQLFQZNW-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 82.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.26 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-ethyl-3-(5-phenyl-1H-1,2,4-triazol-3-yl)urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethyl-3-(5-phenyl-1H-1,2,4-triazol-3-yl)urea?
The IUPAC name of 1-ethyl-3-(5-phenyl-1H-1,2,4-triazol-3-yl)urea (CID 4885272) is 1-ethyl-3-(5-phenyl-1H-1,2,4-triazol-3-yl)urea.
What is the SMILES notation for 1-ethyl-3-(5-phenyl-1H-1,2,4-triazol-3-yl)urea?
The canonical SMILES for 1-ethyl-3-(5-phenyl-1H-1,2,4-triazol-3-yl)urea is CCNC(=O)Nc1n[nH]c(-c2ccccc2)n1.
What is the InChIKey of 1-ethyl-3-(5-phenyl-1H-1,2,4-triazol-3-yl)urea?
The InChIKey is KJHFESGQLFQZNW-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13N5O/c1-2-12-11(17)14-10-13-9(15-16-10)8-6-4-3-5-7-8/h3-7H,2H2,1H3,(H3,12,13,14,15,16,17).
What are the key properties of 1-ethyl-3-(5-phenyl-1H-1,2,4-triazol-3-yl)urea?
1-ethyl-3-(5-phenyl-1H-1,2,4-triazol-3-yl)urea has a molecular weight of 231.26 g/mol, XLogP of 1.61, 3 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethyl-3-(5-phenyl-1H-1,2,4-triazol-3-yl)urea is sourced from PubChem (CID 4885272), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).