C18H19Cl2N3O4S — CID 4885365
N-[(4-chlorophenyl)methyl]-2-[(4-chlorophenyl)sulfonylamino]pentanediamide (PubChem CID 4885365) has the molecular formula C18H19Cl2N3O4S and a molecular weight of 444.34 g/mol. Its IUPAC name is N-[(4-chlorophenyl)methyl]-2-[(4-chlorophenyl)sulfonylamino]pentanediamide.
| Compound Name | N-[(4-chlorophenyl)methyl]-2-[(4-chlorophenyl)sulfonylamino]pentanediamide |
|---|---|
| PubChem CID | 4885365 |
| Molecular Formula | C18H19Cl2N3O4S |
| Molecular Weight | 444.34 g/mol |
| Exact Mass | 443.05 |
| IUPAC Name | N-[(4-chlorophenyl)methyl]-2-[(4-chlorophenyl)sulfonylamino]pentanediamide |
| SMILES | NC(=O)CCC(NS(=O)(=O)c1ccc(Cl)cc1)C(=O)NCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C18H19Cl2N3O4S/c19-13-3-1-12(2-4-13)11-22-18(25)16(9-10-17(21)24)23-28(26,27)15-7-5-14(20)6-8-15/h1-8,16,23H,9-11H2,(H2,21,24)(H,22,25) |
| InChIKey | LVHQPCGWQYJIBP-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 118.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.34 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |