C16H30N2O2 — CID 4886482
1-[2,2-dimethyl-4-(oxolan-2-ylmethyliminomethyl)oxan-4-yl]-N,N-dimethylmethanamine (PubChem CID 4886482) has the molecular formula C16H30N2O2 and a molecular weight of 282.43 g/mol. Its IUPAC name is 1-[2,2-dimethyl-4-(oxolan-2-ylmethyliminomethyl)oxan-4-yl]-N,N-dimethylmethanamine.
| Compound Name | 1-[2,2-dimethyl-4-(oxolan-2-ylmethyliminomethyl)oxan-4-yl]-N,N-dimethylmethanamine |
|---|---|
| PubChem CID | 4886482 |
| Molecular Formula | C16H30N2O2 |
| Molecular Weight | 282.43 g/mol |
| Exact Mass | 282.23 |
| IUPAC Name | 1-[2,2-dimethyl-4-(oxolan-2-ylmethyliminomethyl)oxan-4-yl]-N,N-dimethylmethanamine |
| SMILES | CN(C)CC1(/C=N/CC2CCCO2)CCOC(C)(C)C1 |
| InChI | InChI=1S/C16H30N2O2/c1-15(2)11-16(7-9-20-15,13-18(3)4)12-17-10-14-6-5-8-19-14/h12,14H,5-11,13H2,1-4H3/b17-12+ |
| InChIKey | VPSUMSOXBXSYEH-SFQUDFHCSA-N |
| XLogP | 2.37 |
| TPSA | 34.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.43 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|