C24H20ClN3O3 — CID 4889966
1-(3-chloro-4-methylphenyl)-4'-methylspiro[1,3-diazinane-5,2'-1,3-dihydrobenzo[f]quinoline]-2,4,6-trione (PubChem CID 4889966) has the molecular formula C24H20ClN3O3 and a molecular weight of 433.90 g/mol. Its IUPAC name is 1-(3-chloro-4-methylphenyl)-4'-methylspiro[1,3-diazinane-5,2'-1,3-dihydrobenzo[f]quinoline]-2,4,6-trione.
| Compound Name | 1-(3-chloro-4-methylphenyl)-4'-methylspiro[1,3-diazinane-5,2'-1,3-dihydrobenzo[f]quinoline]-2,4,6-trione |
|---|---|
| PubChem CID | 4889966 |
| Molecular Formula | C24H20ClN3O3 |
| Molecular Weight | 433.90 g/mol |
| Exact Mass | 433.12 |
| IUPAC Name | 1-(3-chloro-4-methylphenyl)-4'-methylspiro[1,3-diazinane-5,2'-1,3-dihydrobenzo[f]quinoline]-2,4,6-trione |
| SMILES | Cc1ccc(N2C(=O)NC(=O)C3(Cc4c(ccc5ccccc45)N(C)C3)C2=O)cc1Cl |
| InChI | InChI=1S/C24H20ClN3O3/c1-14-7-9-16(11-19(14)25)28-22(30)24(21(29)26-23(28)31)12-18-17-6-4-3-5-15(17)8-10-20(18)27(2)13-24/h3-11H,12-13H2,1-2H3,(H,26,29,31) |
| InChIKey | VOUKCSHUPLLTMQ-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.90 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|