C15H28N2O3 — CID 48915772
1-(3-cyclopentyloxypropyl)-3-(4-hydroxycyclohexyl)urea (PubChem CID 48915772) has the molecular formula C15H28N2O3 and a molecular weight of 284.40 g/mol. Its IUPAC name is 1-(3-cyclopentyloxypropyl)-3-(4-hydroxycyclohexyl)urea.
| Compound Name | 1-(3-cyclopentyloxypropyl)-3-(4-hydroxycyclohexyl)urea |
|---|---|
| PubChem CID | 48915772 |
| Molecular Formula | C15H28N2O3 |
| Molecular Weight | 284.40 g/mol |
| Exact Mass | 284.21 |
| IUPAC Name | 1-(3-cyclopentyloxypropyl)-3-(4-hydroxycyclohexyl)urea |
| SMILES | O=C(NCCCOC1CCCC1)NC1CCC(O)CC1 |
| InChI | InChI=1S/C15H28N2O3/c18-13-8-6-12(7-9-13)17-15(19)16-10-3-11-20-14-4-1-2-5-14/h12-14,18H,1-11H2,(H2,16,17,19) |
| InChIKey | LORSRBJHIWEYGC-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.40 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|