C23H19ClFN3O3 — CID 4892098
7-chloro-2'-(4-fluorophenyl)-5-methylspiro[1H-indole-3,4'-3a,6,7,8,8a,8b-hexahydropyrrolo[3,4-a]pyrrolizine]-1',2,3'-trione (PubChem CID 4892098) has the molecular formula C23H19ClFN3O3 and a molecular weight of 439.87 g/mol. Its IUPAC name is 7-chloro-2'-(4-fluorophenyl)-5-methylspiro[1H-indole-3,4'-3a,6,7,8,8a,8b-hexahydropyrrolo[3,4-a]pyrrolizine]-1',2,3'-trione.
| Compound Name | 7-chloro-2'-(4-fluorophenyl)-5-methylspiro[1H-indole-3,4'-3a,6,7,8,8a,8b-hexahydropyrrolo[3,4-a]pyrrolizine]-1',2,3'-trione |
|---|---|
| PubChem CID | 4892098 |
| Molecular Formula | C23H19ClFN3O3 |
| Molecular Weight | 439.87 g/mol |
| Exact Mass | 439.11 |
| IUPAC Name | 7-chloro-2'-(4-fluorophenyl)-5-methylspiro[1H-indole-3,4'-3a,6,7,8,8a,8b-hexahydropyrrolo[3,4-a]pyrrolizine]-1',2,3'-trione |
| SMILES | Cc1cc(Cl)c2c(c1)C1(C(=O)N2)C2C(=O)N(c3ccc(F)cc3)C(=O)C2C2CCCN21 |
| InChI | InChI=1S/C23H19ClFN3O3/c1-11-9-14-19(15(24)10-11)26-22(31)23(14)18-17(16-3-2-8-27(16)23)20(29)28(21(18)30)13-6-4-12(25)5-7-13/h4-7,9-10,16-18H,2-3,8H2,1H3,(H,26,31) |
| InChIKey | KHHKVDWKRIGLCF-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.87 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|