C24H21Cl2N3O4 — CID 124797003
(3S,3'aS,8'aS,8'bS)-7-chloro-2'-(5-chloro-2-methoxyphenyl)-5-methylspiro[1H-indole-3,4'-3a,6,7,8,8a,8b-hexahydropyrrolo[3,4-a]pyrrolizine]-1',2,3'-trione (PubChem CID 124797003) has the molecular formula C24H21Cl2N3O4 and a molecular weight of 486.36 g/mol. Its IUPAC name is (3S,3'aS,8'aS,8'bS)-7-chloro-2'-(5-chloro-2-methoxyphenyl)-5-methylspiro[1H-indole-3,4'-3a,6,7,8,8a,8b-hexahydropyrrolo[3,4-a]pyrrolizine]-1',2,3'-trione.
| Compound Name | (3S,3'aS,8'aS,8'bS)-7-chloro-2'-(5-chloro-2-methoxyphenyl)-5-methylspiro[1H-indole-3,4'-3a,6,7,8,8a,8b-hexahydropyrrolo[3,4-a]pyrrolizine]-1',2,3'-trione |
|---|---|
| PubChem CID | 124797003 |
| Molecular Formula | C24H21Cl2N3O4 |
| Molecular Weight | 486.36 g/mol |
| Exact Mass | 485.09 |
| IUPAC Name | (3S,3'aS,8'aS,8'bS)-7-chloro-2'-(5-chloro-2-methoxyphenyl)-5-methylspiro[1H-indole-3,4'-3a,6,7,8,8a,8b-hexahydropyrrolo[3,4-a]pyrrolizine]-1',2,3'-trione |
| SMILES | COc1ccc(Cl)cc1N1C(=O)[C@@H]2[C@@H]3CCCN3[C@@]3(C(=O)Nc4c(Cl)cc(C)cc43)[C@H]2C1=O |
| InChI | InChI=1S/C24H21Cl2N3O4/c1-11-8-13-20(14(26)9-11)27-23(32)24(13)19-18(15-4-3-7-28(15)24)21(30)29(22(19)31)16-10-12(25)5-6-17(16)33-2/h5-6,8-10,15,18-19H,3-4,7H2,1-2H3,(H,27,32)/t15-,18+,19+,24+/m0/s1 |
| InChIKey | GSFANYPYYXBRJU-LGIZFMHMSA-N |
| XLogP | 3.74 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.36 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|