C25H22ClN3O5 — CID 4835139
methyl 2-(7-chloro-5-methyl-1',2,3'-trioxospiro[1H-indole-3,4'-3a,6,7,8,8a,8b-hexahydropyrrolo[3,4-a]pyrrolizine]-2'-yl)benzoate (PubChem CID 4835139) has the molecular formula C25H22ClN3O5 and a molecular weight of 479.92 g/mol. Its IUPAC name is methyl 2-(7-chloro-5-methyl-1',2,3'-trioxospiro[1H-indole-3,4'-3a,6,7,8,8a,8b-hexahydropyrrolo[3,4-a]pyrrolizine]-2'-yl)benzoate.
| Compound Name | methyl 2-(7-chloro-5-methyl-1',2,3'-trioxospiro[1H-indole-3,4'-3a,6,7,8,8a,8b-hexahydropyrrolo[3,4-a]pyrrolizine]-2'-yl)benzoate |
|---|---|
| PubChem CID | 4835139 |
| Molecular Formula | C25H22ClN3O5 |
| Molecular Weight | 479.92 g/mol |
| Exact Mass | 479.12 |
| IUPAC Name | methyl 2-(7-chloro-5-methyl-1',2,3'-trioxospiro[1H-indole-3,4'-3a,6,7,8,8a,8b-hexahydropyrrolo[3,4-a]pyrrolizine]-2'-yl)benzoate |
| SMILES | COC(=O)c1ccccc1N1C(=O)C2C3CCCN3C3(C(=O)Nc4c(Cl)cc(C)cc43)C2C1=O |
| InChI | InChI=1S/C25H22ClN3O5/c1-12-10-14-20(15(26)11-12)27-24(33)25(14)19-18(17-8-5-9-28(17)25)21(30)29(22(19)31)16-7-4-3-6-13(16)23(32)34-2/h3-4,6-7,10-11,17-19H,5,8-9H2,1-2H3,(H,27,33) |
| InChIKey | VAVWPDXNBGDOPI-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.92 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|