C24H19Cl2N3O5 — CID 130193875
methyl 3-(5,7-dichloro-1',2,3'-trioxospiro[1H-indole-3,4'-3a,6,7,8,8a,8b-hexahydropyrrolo[3,4-a]pyrrolizine]-2'-yl)benzoate (PubChem CID 130193875) has the molecular formula C24H19Cl2N3O5 and a molecular weight of 500.34 g/mol. Its IUPAC name is methyl 3-(5,7-dichloro-1',2,3'-trioxospiro[1H-indole-3,4'-3a,6,7,8,8a,8b-hexahydropyrrolo[3,4-a]pyrrolizine]-2'-yl)benzoate.
| Compound Name | methyl 3-(5,7-dichloro-1',2,3'-trioxospiro[1H-indole-3,4'-3a,6,7,8,8a,8b-hexahydropyrrolo[3,4-a]pyrrolizine]-2'-yl)benzoate |
|---|---|
| PubChem CID | 130193875 |
| Molecular Formula | C24H19Cl2N3O5 |
| Molecular Weight | 500.34 g/mol |
| Exact Mass | 499.07 |
| IUPAC Name | methyl 3-(5,7-dichloro-1',2,3'-trioxospiro[1H-indole-3,4'-3a,6,7,8,8a,8b-hexahydropyrrolo[3,4-a]pyrrolizine]-2'-yl)benzoate |
| SMILES | COC(=O)c1cccc(N2C(=O)C3C4CCCN4C4(C(=O)Nc5c(Cl)cc(Cl)cc54)C3C2=O)c1 |
| InChI | InChI=1S/C24H19Cl2N3O5/c1-34-22(32)11-4-2-5-13(8-11)29-20(30)17-16-6-3-7-28(16)24(18(17)21(29)31)14-9-12(25)10-15(26)19(14)27-23(24)33/h2,4-5,8-10,16-18H,3,6-7H2,1H3,(H,27,33) |
| InChIKey | DPXFZNSYGCMIJL-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.34 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|