C23H18Cl2N4O4 — CID 130193951
methyl 3-(14,16-dichloro-2,4-dioxo-3,10,12,19-tetrazapentacyclo[9.7.1.01,5.06,10.013,18]nonadeca-11(19),13(18),14,16-tetraen-3-yl)benzoate (PubChem CID 130193951) has the molecular formula C23H18Cl2N4O4 and a molecular weight of 485.33 g/mol. Its IUPAC name is methyl 3-(14,16-dichloro-2,4-dioxo-3,10,12,19-tetrazapentacyclo[9.7.1.01,5.06,10.013,18]nonadeca-11(19),13(18),14,16-tetraen-3-yl)benzoate.
| Compound Name | methyl 3-(14,16-dichloro-2,4-dioxo-3,10,12,19-tetrazapentacyclo[9.7.1.01,5.06,10.013,18]nonadeca-11(19),13(18),14,16-tetraen-3-yl)benzoate |
|---|---|
| PubChem CID | 130193951 |
| Molecular Formula | C23H18Cl2N4O4 |
| Molecular Weight | 485.33 g/mol |
| Exact Mass | 484.07 |
| IUPAC Name | methyl 3-(14,16-dichloro-2,4-dioxo-3,10,12,19-tetrazapentacyclo[9.7.1.01,5.06,10.013,18]nonadeca-11(19),13(18),14,16-tetraen-3-yl)benzoate |
| SMILES | COC(=O)c1cccc(N2C(=O)C3C4CCCN4C4=NC3(C2=O)c2cc(Cl)cc(Cl)c2N4)c1 |
| InChI | InChI=1S/C23H18Cl2N4O4/c1-33-20(31)11-4-2-5-13(8-11)29-19(30)17-16-6-3-7-28(16)22-26-18-14(9-12(24)10-15(18)25)23(17,27-22)21(29)32/h2,4-5,8-10,16-17H,3,6-7H2,1H3,(H,26,27) |
| InChIKey | ZQKUDJDHQBDORK-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 91.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.33 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|