About methyl 3-[(1S,2R)-2-(4-chlorophenyl)-2'-oxospiro[cyclopropane-1,3'-indole]-1'-yl]benzoate
methyl 3-[(1S,2R)-2-(4-chlorophenyl)-2'-oxospiro[cyclopropane-1,3'-indole]-1'-yl]benzoate (PubChem CID 58305377) has the molecular formula C24H18ClNO3
and a molecular weight of 403.87 g/mol. Its IUPAC name is methyl 3-[(1S,2R)-2-(4-chlorophenyl)-2'-oxospiro[cyclopropane-1,3'-indole]-1'-yl]benzoate.
Molecular Properties
| Compound Name | methyl 3-[(1S,2R)-2-(4-chlorophenyl)-2'-oxospiro[cyclopropane-1,3'-indole]-1'-yl]benzoate |
| PubChem CID | 58305377 |
| Molecular Formula | C24H18ClNO3 |
| Molecular Weight | 403.87 g/mol |
| Exact Mass | 403.10 |
| IUPAC Name | methyl 3-[(1S,2R)-2-(4-chlorophenyl)-2'-oxospiro[cyclopropane-1,3'-indole]-1'-yl]benzoate |
| SMILES | COC(=O)c1cccc(N2C(=O)[C@]3(C[C@@H]3c3ccc(Cl)cc3)c3ccccc32)c1 |
| InChI | InChI=1S/C24H18ClNO3/c1-29-22(27)16-5-4-6-18(13-16)26-21-8-3-2-7-19(21)24(23(26)28)14-20(24)15-9-11-17(25)12-10-15/h2-13,20H,14H2,1H3/t20-,24-/m1/s1 |
| InChIKey | DYRJQOPFGOUVHJ-HYBUGGRVSA-N |
| XLogP | 5.23 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 403.87 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze methyl 3-[(1S,2R)-2-(4-chlorophenyl)-2'-oxospiro[cyclopropane-1,3'-indole]-1'-yl]benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 3-[(1S,2R)-2-(4-chlorophenyl)-2'-oxospiro[cyclopropane-1,3'-indole]-1'-yl]benzoate?
The IUPAC name of methyl 3-[(1S,2R)-2-(4-chlorophenyl)-2'-oxospiro[cyclopropane-1,3'-indole]-1'-yl]benzoate (CID 58305377) is methyl 3-[(1S,2R)-2-(4-chlorophenyl)-2'-oxospiro[cyclopropane-1,3'-indole]-1'-yl]benzoate.
What is the SMILES notation for methyl 3-[(1S,2R)-2-(4-chlorophenyl)-2'-oxospiro[cyclopropane-1,3'-indole]-1'-yl]benzoate?
The canonical SMILES for methyl 3-[(1S,2R)-2-(4-chlorophenyl)-2'-oxospiro[cyclopropane-1,3'-indole]-1'-yl]benzoate is COC(=O)c1cccc(N2C(=O)[C@]3(C[C@@H]3c3ccc(Cl)cc3)c3ccccc32)c1.
What is the InChIKey of methyl 3-[(1S,2R)-2-(4-chlorophenyl)-2'-oxospiro[cyclopropane-1,3'-indole]-1'-yl]benzoate?
The InChIKey is DYRJQOPFGOUVHJ-HYBUGGRVSA-N. The full InChI is InChI=1S/C24H18ClNO3/c1-29-22(27)16-5-4-6-18(13-16)26-21-8-3-2-7-19(21)24(23(26)28)14-20(24)15-9-11-17(25)12-10-15/h2-13,20H,14H2,1H3/t20-,24-/m1/s1.
What are the key properties of methyl 3-[(1S,2R)-2-(4-chlorophenyl)-2'-oxospiro[cyclopropane-1,3'-indole]-1'-yl]benzoate?
methyl 3-[(1S,2R)-2-(4-chlorophenyl)-2'-oxospiro[cyclopropane-1,3'-indole]-1'-yl]benzoate has a molecular weight of 403.87 g/mol, XLogP of 5.23, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-[(1S,2R)-2-(4-chlorophenyl)-2'-oxospiro[cyclopropane-1,3'-indole]-1'-yl]benzoate is sourced from PubChem (CID 58305377), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).