C27H21NO4 — CID 27525908
methyl 3-[(15R,19R)-1-methyl-16,18-dioxo-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaen-17-yl]benzoate (PubChem CID 27525908) has the molecular formula C27H21NO4 and a molecular weight of 423.47 g/mol. Its IUPAC name is methyl 3-[(15R,19R)-1-methyl-16,18-dioxo-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaen-17-yl]benzoate.
| Compound Name | methyl 3-[(15R,19R)-1-methyl-16,18-dioxo-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaen-17-yl]benzoate |
|---|---|
| PubChem CID | 27525908 |
| Molecular Formula | C27H21NO4 |
| Molecular Weight | 423.47 g/mol |
| Exact Mass | 423.15 |
| IUPAC Name | methyl 3-[(15R,19R)-1-methyl-16,18-dioxo-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaen-17-yl]benzoate |
| SMILES | COC(=O)c1cccc(N2C(=O)[C@@H]3C4c5ccccc5C(C)(c5ccccc54)[C@@H]3C2=O)c1 |
| InChI | InChI=1S/C27H21NO4/c1-27-19-12-5-3-10-17(19)21(18-11-4-6-13-20(18)27)22-23(27)25(30)28(24(22)29)16-9-7-8-15(14-16)26(31)32-2/h3-14,21-23H,1-2H3/t21?,22-,23+,27?/m1/s1 |
| InChIKey | PALMFLGUGCLKOV-FPAXGFGJSA-N |
| XLogP | 4.04 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.47 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|