C26H18N2O6 — CID 126377142
methyl 3-[(15S,19R)-1-nitro-16,18-dioxo-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaen-17-yl]benzoate (PubChem CID 126377142) has the molecular formula C26H18N2O6 and a molecular weight of 454.44 g/mol. Its IUPAC name is methyl 3-[(15S,19R)-1-nitro-16,18-dioxo-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaen-17-yl]benzoate.
| Compound Name | methyl 3-[(15S,19R)-1-nitro-16,18-dioxo-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaen-17-yl]benzoate |
|---|---|
| PubChem CID | 126377142 |
| Molecular Formula | C26H18N2O6 |
| Molecular Weight | 454.44 g/mol |
| Exact Mass | 454.12 |
| IUPAC Name | methyl 3-[(15S,19R)-1-nitro-16,18-dioxo-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaen-17-yl]benzoate |
| SMILES | COC(=O)c1cccc(N2C(=O)[C@@H]3C4c5ccccc5C([N+](=O)[O-])(c5ccccc54)[C@H]3C2=O)c1 |
| InChI | InChI=1S/C26H18N2O6/c1-34-25(31)14-7-6-8-15(13-14)27-23(29)21-20-16-9-2-4-11-18(16)26(28(32)33,22(21)24(27)30)19-12-5-3-10-17(19)20/h2-13,20-22H,1H3/t20?,21-,22-,26?/m1/s1 |
| InChIKey | MEEWHHZIXXRVSS-OLJONYEBSA-N |
| XLogP | 3.26 |
| TPSA | 106.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.44 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|