C26H18N2O5 — CID 1327558
(15R,19S)-17-(3-acetylphenyl)-1-nitro-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaene-16,18-dione (PubChem CID 1327558) has the molecular formula C26H18N2O5 and a molecular weight of 438.44 g/mol. Its IUPAC name is (15R,19S)-17-(3-acetylphenyl)-1-nitro-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaene-16,18-dione.
| Compound Name | (15R,19S)-17-(3-acetylphenyl)-1-nitro-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaene-16,18-dione |
|---|---|
| PubChem CID | 1327558 |
| Molecular Formula | C26H18N2O5 |
| Molecular Weight | 438.44 g/mol |
| Exact Mass | 438.12 |
| IUPAC Name | (15R,19S)-17-(3-acetylphenyl)-1-nitro-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaene-16,18-dione |
| SMILES | CC(=O)c1cccc(N2C(=O)[C@@H]3[C@@H](C2=O)C2c4ccccc4C3([N+](=O)[O-])c3ccccc32)c1 |
| InChI | InChI=1S/C26H18N2O5/c1-14(29)15-7-6-8-16(13-15)27-24(30)22-21-17-9-2-4-11-19(17)26(28(32)33,23(22)25(27)31)20-12-5-3-10-18(20)21/h2-13,21-23H,1H3/t21?,22-,23-,26?/m0/s1 |
| InChIKey | OHWJYMZSLBMNKV-ZQFKLAOWSA-N |
| XLogP | 3.67 |
| TPSA | 97.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.44 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|