C27H20N2O6 — CID 2940203
ethyl 4-(1-nitro-16,18-dioxo-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaen-17-yl)benzoate (PubChem CID 2940203) has the molecular formula C27H20N2O6 and a molecular weight of 468.47 g/mol. Its IUPAC name is ethyl 4-(1-nitro-16,18-dioxo-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaen-17-yl)benzoate.
| Compound Name | ethyl 4-(1-nitro-16,18-dioxo-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaen-17-yl)benzoate |
|---|---|
| PubChem CID | 2940203 |
| Molecular Formula | C27H20N2O6 |
| Molecular Weight | 468.47 g/mol |
| Exact Mass | 468.13 |
| IUPAC Name | ethyl 4-(1-nitro-16,18-dioxo-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaen-17-yl)benzoate |
| SMILES | CCOC(=O)c1ccc(N2C(=O)C3C4c5ccccc5C([N+](=O)[O-])(c5ccccc54)C3C2=O)cc1 |
| InChI | InChI=1S/C27H20N2O6/c1-2-35-26(32)15-11-13-16(14-12-15)28-24(30)22-21-17-7-3-5-9-19(17)27(29(33)34,23(22)25(28)31)20-10-6-4-8-18(20)21/h3-14,21-23H,2H2,1H3 |
| InChIKey | MPPYDAZADSDHOL-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 106.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.47 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|