C27H21NO4 — CID 1362489
[3-[(15S,19R)-1-methyl-16,18-dioxo-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaen-17-yl]phenyl] acetate (PubChem CID 1362489) has the molecular formula C27H21NO4 and a molecular weight of 423.47 g/mol. Its IUPAC name is [3-[(15S,19R)-1-methyl-16,18-dioxo-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaen-17-yl]phenyl] acetate.
| Compound Name | [3-[(15S,19R)-1-methyl-16,18-dioxo-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaen-17-yl]phenyl] acetate |
|---|---|
| PubChem CID | 1362489 |
| Molecular Formula | C27H21NO4 |
| Molecular Weight | 423.47 g/mol |
| Exact Mass | 423.15 |
| IUPAC Name | [3-[(15S,19R)-1-methyl-16,18-dioxo-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaen-17-yl]phenyl] acetate |
| SMILES | CC(=O)Oc1cccc(N2C(=O)[C@@H]3C4c5ccccc5C(C)(c5ccccc54)[C@H]3C2=O)c1 |
| InChI | InChI=1S/C27H21NO4/c1-15(29)32-17-9-7-8-16(14-17)28-25(30)23-22-18-10-3-5-12-20(18)27(2,24(23)26(28)31)21-13-6-4-11-19(21)22/h3-14,22-24H,1-2H3/t22?,23-,24-,27?/m1/s1 |
| InChIKey | SQEULOSKSMKGEX-PGAZUGQPSA-N |
| XLogP | 4.18 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.47 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|