C24H20ClN3O5 — CID 4888097
[4-(7-chloro-1',2,3'-trioxospiro[1H-indole-3,4'-3a,6,7,8,8a,8b-hexahydropyrrolo[3,4-a]pyrrolizine]-2'-yl)phenyl] acetate (PubChem CID 4888097) has the molecular formula C24H20ClN3O5 and a molecular weight of 465.89 g/mol. Its IUPAC name is [4-(7-chloro-1',2,3'-trioxospiro[1H-indole-3,4'-3a,6,7,8,8a,8b-hexahydropyrrolo[3,4-a]pyrrolizine]-2'-yl)phenyl] acetate.
| Compound Name | [4-(7-chloro-1',2,3'-trioxospiro[1H-indole-3,4'-3a,6,7,8,8a,8b-hexahydropyrrolo[3,4-a]pyrrolizine]-2'-yl)phenyl] acetate |
|---|---|
| PubChem CID | 4888097 |
| Molecular Formula | C24H20ClN3O5 |
| Molecular Weight | 465.89 g/mol |
| Exact Mass | 465.11 |
| IUPAC Name | [4-(7-chloro-1',2,3'-trioxospiro[1H-indole-3,4'-3a,6,7,8,8a,8b-hexahydropyrrolo[3,4-a]pyrrolizine]-2'-yl)phenyl] acetate |
| SMILES | CC(=O)Oc1ccc(N2C(=O)C3C4CCCN4C4(C(=O)Nc5c(Cl)cccc54)C3C2=O)cc1 |
| InChI | InChI=1S/C24H20ClN3O5/c1-12(29)33-14-9-7-13(8-10-14)28-21(30)18-17-6-3-11-27(17)24(19(18)22(28)31)15-4-2-5-16(25)20(15)26-23(24)32/h2,4-5,7-10,17-19H,3,6,11H2,1H3,(H,26,32) |
| InChIKey | FMGVVSBXTFKUNG-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.89 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|