C25H22ClN3O4 — CID 3980017
2'-(4-acetylphenyl)-6-chloro-7-methylspiro[1H-indole-3,4'-3a,6,7,8,8a,8b-hexahydropyrrolo[3,4-a]pyrrolizine]-1',2,3'-trione (PubChem CID 3980017) has the molecular formula C25H22ClN3O4 and a molecular weight of 463.92 g/mol. Its IUPAC name is 2'-(4-acetylphenyl)-6-chloro-7-methylspiro[1H-indole-3,4'-3a,6,7,8,8a,8b-hexahydropyrrolo[3,4-a]pyrrolizine]-1',2,3'-trione.
| Compound Name | 2'-(4-acetylphenyl)-6-chloro-7-methylspiro[1H-indole-3,4'-3a,6,7,8,8a,8b-hexahydropyrrolo[3,4-a]pyrrolizine]-1',2,3'-trione |
|---|---|
| PubChem CID | 3980017 |
| Molecular Formula | C25H22ClN3O4 |
| Molecular Weight | 463.92 g/mol |
| Exact Mass | 463.13 |
| IUPAC Name | 2'-(4-acetylphenyl)-6-chloro-7-methylspiro[1H-indole-3,4'-3a,6,7,8,8a,8b-hexahydropyrrolo[3,4-a]pyrrolizine]-1',2,3'-trione |
| SMILES | CC(=O)c1ccc(N2C(=O)C3C4CCCN4C4(C(=O)Nc5c4ccc(Cl)c5C)C3C2=O)cc1 |
| InChI | InChI=1S/C25H22ClN3O4/c1-12-17(26)10-9-16-21(12)27-24(33)25(16)20-19(18-4-3-11-28(18)25)22(31)29(23(20)32)15-7-5-14(6-8-15)13(2)30/h5-10,18-20H,3-4,11H2,1-2H3,(H,27,33) |
| InChIKey | OIDDGULDAIZMGC-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.92 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|