C24H20ClN3O5 — CID 51705077
(3R,3'aR,8'aR,8'bS)-2'-(1,3-benzodioxol-5-yl)-6-chloro-7-methylspiro[1H-indole-3,4'-3a,6,7,8,8a,8b-hexahydropyrrolo[3,4-a]pyrrolizine]-1',2,3'-trione (PubChem CID 51705077) has the molecular formula C24H20ClN3O5 and a molecular weight of 465.89 g/mol. Its IUPAC name is (3R,3'aR,8'aR,8'bS)-2'-(1,3-benzodioxol-5-yl)-6-chloro-7-methylspiro[1H-indole-3,4'-3a,6,7,8,8a,8b-hexahydropyrrolo[3,4-a]pyrrolizine]-1',2,3'-trione.
| Compound Name | (3R,3'aR,8'aR,8'bS)-2'-(1,3-benzodioxol-5-yl)-6-chloro-7-methylspiro[1H-indole-3,4'-3a,6,7,8,8a,8b-hexahydropyrrolo[3,4-a]pyrrolizine]-1',2,3'-trione |
|---|---|
| PubChem CID | 51705077 |
| Molecular Formula | C24H20ClN3O5 |
| Molecular Weight | 465.89 g/mol |
| Exact Mass | 465.11 |
| IUPAC Name | (3R,3'aR,8'aR,8'bS)-2'-(1,3-benzodioxol-5-yl)-6-chloro-7-methylspiro[1H-indole-3,4'-3a,6,7,8,8a,8b-hexahydropyrrolo[3,4-a]pyrrolizine]-1',2,3'-trione |
| SMILES | Cc1c(Cl)ccc2c1NC(=O)[C@@]21[C@@H]2C(=O)N(c3ccc4c(c3)OCO4)C(=O)[C@@H]2[C@H]2CCCN21 |
| InChI | InChI=1S/C24H20ClN3O5/c1-11-14(25)6-5-13-20(11)26-23(31)24(13)19-18(15-3-2-8-27(15)24)21(29)28(22(19)30)12-4-7-16-17(9-12)33-10-32-16/h4-7,9,15,18-19H,2-3,8,10H2,1H3,(H,26,31)/t15-,18-,19+,24+/m1/s1 |
| InChIKey | NFPIGKHDJZHKST-RSOWOLOUSA-N |
| XLogP | 2.81 |
| TPSA | 88.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.89 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|