About 1-[(3-butyl-7-ethyl-2,6-dioxopurin-8-yl)methyl]-N-ethylpiperidine-3-carboxamide
1-[(3-butyl-7-ethyl-2,6-dioxopurin-8-yl)methyl]-N-ethylpiperidine-3-carboxamide (PubChem CID 48937739) has the molecular formula C20H32N6O3
and a molecular weight of 404.52 g/mol. Its IUPAC name is 1-[(3-butyl-7-ethyl-2,6-dioxopurin-8-yl)methyl]-N-ethylpiperidine-3-carboxamide.
Molecular Properties
| Compound Name | 1-[(3-butyl-7-ethyl-2,6-dioxopurin-8-yl)methyl]-N-ethylpiperidine-3-carboxamide |
| PubChem CID | 48937739 |
| Molecular Formula | C20H32N6O3 |
| Molecular Weight | 404.52 g/mol |
| Exact Mass | 404.25 |
| IUPAC Name | 1-[(3-butyl-7-ethyl-2,6-dioxopurin-8-yl)methyl]-N-ethylpiperidine-3-carboxamide |
| SMILES | CCCCn1c(=O)[nH]c(=O)c2c1nc(CN1CCCC(C(=O)NCC)C1)n2CC |
| InChI | InChI=1S/C20H32N6O3/c1-4-7-11-26-17-16(19(28)23-20(26)29)25(6-3)15(22-17)13-24-10-8-9-14(12-24)18(27)21-5-2/h14H,4-13H2,1-3H3,(H,21,27)(H,23,28,29) |
| InChIKey | IQHHXPYCKUFGGV-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 105.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 404.52 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 1-[(3-butyl-7-ethyl-2,6-dioxopurin-8-yl)methyl]-N-ethylpiperidine-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(3-butyl-7-ethyl-2,6-dioxopurin-8-yl)methyl]-N-ethylpiperidine-3-carboxamide?
The IUPAC name of 1-[(3-butyl-7-ethyl-2,6-dioxopurin-8-yl)methyl]-N-ethylpiperidine-3-carboxamide (CID 48937739) is 1-[(3-butyl-7-ethyl-2,6-dioxopurin-8-yl)methyl]-N-ethylpiperidine-3-carboxamide.
What is the SMILES notation for 1-[(3-butyl-7-ethyl-2,6-dioxopurin-8-yl)methyl]-N-ethylpiperidine-3-carboxamide?
The canonical SMILES for 1-[(3-butyl-7-ethyl-2,6-dioxopurin-8-yl)methyl]-N-ethylpiperidine-3-carboxamide is CCCCn1c(=O)[nH]c(=O)c2c1nc(CN1CCCC(C(=O)NCC)C1)n2CC.
What is the InChIKey of 1-[(3-butyl-7-ethyl-2,6-dioxopurin-8-yl)methyl]-N-ethylpiperidine-3-carboxamide?
The InChIKey is IQHHXPYCKUFGGV-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H32N6O3/c1-4-7-11-26-17-16(19(28)23-20(26)29)25(6-3)15(22-17)13-24-10-8-9-14(12-24)18(27)21-5-2/h14H,4-13H2,1-3H3,(H,21,27)(H,23,28,29).
What are the key properties of 1-[(3-butyl-7-ethyl-2,6-dioxopurin-8-yl)methyl]-N-ethylpiperidine-3-carboxamide?
1-[(3-butyl-7-ethyl-2,6-dioxopurin-8-yl)methyl]-N-ethylpiperidine-3-carboxamide has a molecular weight of 404.52 g/mol, XLogP of 1.05, 8 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(3-butyl-7-ethyl-2,6-dioxopurin-8-yl)methyl]-N-ethylpiperidine-3-carboxamide is sourced from PubChem (CID 48937739), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).