C15H23N5O3S — CID 48964508
2-[[1-(thiophen-2-ylmethyl)piperidin-4-yl]methylcarbamoylamino]propanediamide (PubChem CID 48964508) has the molecular formula C15H23N5O3S and a molecular weight of 353.45 g/mol. Its IUPAC name is 2-[[1-(thiophen-2-ylmethyl)piperidin-4-yl]methylcarbamoylamino]propanediamide.
| Compound Name | 2-[[1-(thiophen-2-ylmethyl)piperidin-4-yl]methylcarbamoylamino]propanediamide |
|---|---|
| PubChem CID | 48964508 |
| Molecular Formula | C15H23N5O3S |
| Molecular Weight | 353.45 g/mol |
| Exact Mass | 353.15 |
| IUPAC Name | 2-[[1-(thiophen-2-ylmethyl)piperidin-4-yl]methylcarbamoylamino]propanediamide |
| SMILES | NC(=O)C(NC(=O)NCC1CCN(Cc2cccs2)CC1)C(N)=O |
| InChI | InChI=1S/C15H23N5O3S/c16-13(21)12(14(17)22)19-15(23)18-8-10-3-5-20(6-4-10)9-11-2-1-7-24-11/h1-2,7,10,12H,3-6,8-9H2,(H2,16,21)(H2,17,22)(H2,18,19,23) |
| InChIKey | ANJLKNJTUYZZDX-UHFFFAOYSA-N |
| XLogP | -0.40 |
| TPSA | 130.55 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.45 |
| LogP ≤ 5 | -0.40 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|