C18H28N2OS — CID 94820546
(3R)-3-cyclopropyl-N-[[1-(thiophen-2-ylmethyl)piperidin-4-yl]methyl]butanamide (PubChem CID 94820546) has the molecular formula C18H28N2OS and a molecular weight of 320.50 g/mol. Its IUPAC name is (3R)-3-cyclopropyl-N-[[1-(thiophen-2-ylmethyl)piperidin-4-yl]methyl]butanamide.
| Compound Name | (3R)-3-cyclopropyl-N-[[1-(thiophen-2-ylmethyl)piperidin-4-yl]methyl]butanamide |
|---|---|
| PubChem CID | 94820546 |
| Molecular Formula | C18H28N2OS |
| Molecular Weight | 320.50 g/mol |
| Exact Mass | 320.19 |
| IUPAC Name | (3R)-3-cyclopropyl-N-[[1-(thiophen-2-ylmethyl)piperidin-4-yl]methyl]butanamide |
| SMILES | C[C@H](CC(=O)NCC1CCN(Cc2cccs2)CC1)C1CC1 |
| InChI | InChI=1S/C18H28N2OS/c1-14(16-4-5-16)11-18(21)19-12-15-6-8-20(9-7-15)13-17-3-2-10-22-17/h2-3,10,14-16H,4-9,11-13H2,1H3,(H,19,21)/t14-/m1/s1 |
| InChIKey | LVLRQKWZMJNZAB-CQSZACIVSA-N |
| XLogP | 3.51 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.50 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |